On Target ADRB2_HUMAN 0.47058824/CHEMBL154906
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.47058824, the most similar ligand is CHEMBL154906. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL154906 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | C[C@H](CNc1cccc(CNC(=O)NS(=O)(=O)c2ccccc2)c1)NC[C@H](O)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 1000c012 14800000 41100120 06b10e00 20000080 08004000 0c000000 02003000 00800180 00082a50 09202004 e0008c00 02008806 00002041 80320040 00080008 12042000 02000000 08400000 00006200 c0102080 38218520 22000001 8b48001a 00042000 80000000 80000000 8000048c 0c408500 20060003 40040000 80030660 |