On Target PPARG_HUMAN 0.4/CHEMBL218176
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL218176. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL218176 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | FC(F)(F)c1cccc(Cn2c(cc3ccccc23)C(=O)NS(=O)(=O)c4ccc(Cl)cc4)c1 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00008012 00829a00 01180100 11b10600 000c1021 10000000 04000401 00001005 80100000 000038d0 00b92004 60018c02 02009804 01500001 90220040 0204000c 02002008 02100004 02680000 00006000 c0000000 18078718 20802000 8940000c 02102000 c0000004 d8000000 9000000c 04000404 20060049 80140200 00034360 |