On Target PPARG_HUMAN 0.35813954/CHEMBL461944
For the given ligand Omeprazole, we have found in our database that, being scored 0.35813954, the most similar ligand is CHEMBL461944. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL461944 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | C[C@H](Oc1cc(Cn2c(C)c(Oc3ccc(Cl)cc3)c4ccc(Cl)nc24)ccc1Cl)C(=O)O |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 04008002 46800208 60104108 10410600 000c1030 00004004 16000000 00201008 80100104 000008c4 0104000c 4005d800 03809846 0ad00080 c1220865 030c200c 00000000 82000404 02682100 00060200 c0400000 18008b30 25800041 8940a110 00006c40 c0008a00 00140008 00a00000 04400304 00460048 400e2600 00260480 |