On Target CASP1_HUMAN 0.3219178/CHEMBL422849
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.3219178, the most similar ligand is CHEMBL422849. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL422849 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | OC(=O)C[C@H](NC(=O)c1ccc(CNS(=O)(=O)c2ccc(O)c(c2)C(=O)O)cc1)C=O |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00048010 00805809 21188100 41b10600 00080120 00034000 06000001 02001800 02000100 00001840 00302000 6000b000 8e008802 00000001 80200480 00082108 00002000 02100001 00c00810 00026201 80000000 18128e20 01000080 0840001c 02001001 c0000004 40000000 8000108c 00000502 20060001 e0044000 40010360 |