On Target CASP1_HUMAN 0.27450982/CHEMBL3133256
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.27450982, the most similar ligand is CHEMBL3133256. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL3133256 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | FC[C@@H]1CCCN1S(=O)(=O)c2ccc3N(Cc4ccccc4I)C(=O)C(=O)c3c2 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 1000c012 01a02801 21182100 01b10600 20080930 00018050 00000000 02081008 04800280 804808c0 08282004 6001f000 03008842 02500081 c06205c0 00000100 0004a000 02000000 08400100 00006601 c0110440 18228600 20012000 9974009d 02000000 c0000284 00000030 900010cc 0408a500 22060043 a0247000 60010671 |