On Target CASP1_HUMAN 0.19402985/CHEMBL1221744
For the given ligand Hydralazine, we have found in our database that, being scored 0.19402985, the most similar ligand is CHEMBL1221744. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL1221744 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | CC(C)[C@H](CC(=O)NCCc1cc(nc2ccccc12)N(C)C)C(=O)N[C@@H](CC(=O)O)C=O |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 00070002 01001800 00104100 40010600 00040004 00000000 00000000 20000004 00600080 000808d0 08200004 4003b000 9e008802 00401000 80000040 000c000c 00040000 02004001 08e00010 00a00201 44000000 1c308e08 21800880 81700018 00043001 80000000 00000080 10000080 0400800a 00060803 20044000 00802620 |