On Target CASP1_HUMAN 0.4556213/CHEMBL200819
For the given ligand Oseltamivir, we have found in our database that, being scored 0.4556213, the most similar ligand is CHEMBL200819. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL200819 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | OC1OC(=O)C[C@@H]1NC(=O)[C@@H]2COC[C@@H]3C\C=C/C[C@H](NC(=O)c4ccccc4)C(=O)N23 |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00048040 88007800 00100300 84010f00 00240080 00200000 00080800 2200140a 10000000 001108e8 00200000 4100b000 1e028802 00082003 80181408 00281108 10264000 02000041 40c00010 02002201 00000020 38128e00 13008083 0240001c 10201401 c0000000 00c00000 b0000001 0c000300 80060401 a4444000 00002200 |