On Target PPAP_HUMAN 0.10465116/CHEMBL507996
For the given ligand Oseltamivir, we have found in our database that, being scored 0.10465116, the most similar ligand is CHEMBL507996. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL507996 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | Cl.COc1ccc(cc1)[C@@H](N[C@H](C)c2ccccc2)P(=O)(O)O |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00010010 00000608 20000108 00010600 00001000 00400000 06040000 82001000 000000c0 00080840 08200000 40008000 00000802 00020000 8108040d 00000008 00003028 02000000 00000000 00020200 00000000 0d308000 00000000 00400010 00000000 c6010006 00220000 80014000 00000300 30060002 00040000 00028603 |