On Target CHLE_HUMAN 0.3539823/CHEMBL3918754
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.3539823, the most similar ligand is CHEMBL3918754. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL3918754 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | COCCCN(CC1CCN(CC#C)CC1)S(=O)(=O)c2ccc3ccccc3c2 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00000010 03800000 01100100 01b10600 00482000 00000000 20000000 20100000 00200000 004008c0 00202000 70038000 00000002 00000001 81700000 00080008 00202000 00400000 00c00000 00006605 80000000 18000008 01010080 18500018 02000001 00000004 00000000 1000000c 00000600 20060000 00000020 00012270 |