On Target PDE4B_HUMAN 0.31288344/CHEMBL576479
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.31288344, the most similar ligand is CHEMBL576479. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL576479 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | COc1cccc(Nc2c(cnc3ccc(cc23)S(=O)(=O)N(C)C)C(=O)N)c1 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00000012 8080a808 21004108 00b10610 00041010 00010000 0200c010 00001048 00802000 00000840 01302004 60008000 00008802 08400001 816200c1 0004000c 00042000 02000004 08608002 00826c01 c0000000 08068608 20800000 8840000c 00040000 80000100 0a008000 000110cc 00408600 20260000 80040000 c0030060 |