On Target ACM4_HUMAN 0.38392857/CHEMBL1455766
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.38392857, the most similar ligand is CHEMBL1455766. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL1455766 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CC(C)N(CCNC(=O)c1ccc(CNS(=O)(=O)c2ccc(C)cc2)cc1)Cc3ccccc3 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00000010 00803800 01080100 45b10600 00080008 00000000 04000001 02001008 00000100 00011840 00302000 60008000 80008802 00002001 80200400 00000000 00002000 02100000 00400000 00006000 80000000 28028600 00000000 0a40001c 02000000 c0000004 40000000 8000002c 08000500 20060001 80040000 00010360 |