On Target ACM4_HUMAN 0.33742332/CHEMBL4082397
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.33742332, the most similar ligand is CHEMBL4082397. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL4082397 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CC1(C)CCCN(C1)c2ccc(nn2)N3CCN(CC3)S(=O)(=O)c4ccccc4Cl |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0000c093 01801009 21100020 05b00600 20080000 00002000 00820000 20000000 00000000 10004ac0 00202004 70018800 02000006 00002001 80220000 0014c00c 00042000 00000008 08600000 00226605 80100000 3c040100 20800820 2a50803a 02122000 00080004 20000000 100000cc 08000418 20060000 00000c02 20332260 |