On Target ACM4_HUMAN 0.25490198/CHEMBL7568
For the given ligand Hydralazine, we have found in our database that, being scored 0.25490198, the most similar ligand is CHEMBL7568. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL7568 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | CCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc3ccc(OC)cc13 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 0001c002 01000008 20104008 00000600 200c1000 00002000 0a088000 20000008 00200000 000008c0 00200004 40038800 02000826 00400000 01020041 0004000c 00040000 00000000 08200000 00020201 40100000 18048108 20800000 80100010 00006000 00000000 00048000 10000080 00008200 00060000 00040000 00420240 |