On Target TNFA_HUMAN 0.32692307/CHEMBL1709705
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.32692307, the most similar ligand is CHEMBL1709705. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL1709705 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CCC(=O)N1C(C)Cc2cc(ccc12)S(=O)(=O)N3CCN(CC3)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 1000c092 00803000 01102120 05b10600 20080110 00010040 00020000 0000000c 00800880 00080a40 08382024 6000d800 02008006 00102001 802201c0 00008102 0004a000 02000000 08600008 00006201 c0100100 38200700 20002020 ab40003b 02002000 80000004 00080010 000010cc 0c088400 20060003 00000082 22132661 |