On Target TNFA_HUMAN 0.33333334/CHEMBL1709705
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL1709705. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL1709705 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CCC(=O)N1C(C)Cc2cc(ccc12)S(=O)(=O)N3CCN(CC3)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 1000c092 00803000 01102120 05b10600 20080110 00010040 00020000 0000000c 00800880 00080a40 08382024 6000d800 02008006 00102001 802201c0 00008102 0004a000 02000000 08600008 00006201 c0100100 38200700 20002020 ab40003b 02002000 80000004 00080010 000010cc 0c088400 20060003 00000082 22132661 |