On Target TNFA_HUMAN 0.33953488/CHEMBL2337619
For the given ligand Oseltamivir, we have found in our database that, being scored 0.33953488, the most similar ligand is CHEMBL2337619. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL2337619 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CCCCCCOC(=O)\C=C\c1cc(OC)c(O)c2c1C[C@@H]3[C@@H]4C=C(OC)C(=O)C[C@]24CCN3C |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 100d0000 4b000208 2010010a 00110700 20081021 c0002002 870c0180 2000060b 01800880 001888ca 48300000 5191d040 8402c01a 20a00000 03000423 020cb00a 20820600 82000060 2049a018 00020201 00100120 18200a90 0100c001 81540010 00201c00 80002001 04526008 d0000580 04404202 0026c50a 2c020000 00012710 |