On Target ACHA9_HUMAN 0.14611872/CHEMBL386114
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.14611872, the most similar ligand is CHEMBL386114. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL386114 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | C[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)CN)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00070002 01007a00 00100100 45910e10 00141282 00000010 00012000 2000000c 00600880 020f08c2 08300014 4003b000 1e008812 00442809 80180040 000c000c 10000800 02000001 00e00418 00400301 40000100 38348e28 23800283 97500018 00043801 80000000 48010000 10000000 0c000002 0006002b 20044200 03812e20 |