On Target BACE1_HUMAN 0.23972602/CHEMBL3354257
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.23972602, the most similar ligand is CHEMBL3354257. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL3354257 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CN1C(=N)N[C@](CCC2CCCCC2)(C[C@H]3CCC[C@H](C3)NC(=O)Nc4ccc(Cl)cc4)C1=O |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00018006 01001000 00100000 00000e00 00000000 00000000 00000004 00002001 00000640 000008c2 00280004 4001b800 0600900c 00102000 00000040 00100000 00050000 00402000 0a002000 00000001 40010100 38050730 20022000 00100018 00112000 00000000 40080000 10000080 08008010 00060001 800a4000 02024200 |