On Target BACE1_HUMAN 0.4379085/CHEMBL2047043
For the given ligand Oseltamivir, we have found in our database that, being scored 0.4379085, the most similar ligand is CHEMBL2047043. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL2047043 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CC(C)c1cccc(CNC[C@@H](O)[C@@H]2COC\C=C\CCNC(=O)c3cc(C)cc(c3)C(=O)N2)c1 |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00040008 08005c00 00100100 80010700 001000c1 00000800 12880000 32001400 00000000 01180de8 48200000 40008000 00008802 00000000 00001408 08081008 10000000 02000040 61400c10 00000201 00000120 180a8600 13008000 0040001c 00001400 c0000400 08c00200 90000001 00000300 00060413 a4040000 00000e10 |