On Target NOS1_HUMAN 0.46616542/CHEMBL1800523
For the given ligand Omeprazole, we have found in our database that, being scored 0.46616542, the most similar ligand is CHEMBL1800523. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL1800523 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | COc1ccnc(CSC)c1 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00000002 40000008 20006508 10100200 00040020 00000000 00000000 00000008 00000000 00014041 00000004 42000000 00001800 40040000 01020000 0204000c 04000008 02000304 80280000 00040000 40000002 0800a000 20800000 00400000 00200000 80000000 40000040 00000000 00000204 00860000 00000000 00250000 |