On Target NK1R_HUMAN 0.27272728/CHEMBL345866
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.27272728, the most similar ligand is CHEMBL345866. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL345866 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CCCCCN(CCCCC)C(=O)[C@H]1CCN([C@@H](C1)C(=O)NCCNCC(=O)N)C(=O)N(c2ccccc2)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00038006 01003000 00100000 06000e00 00000000 00000000 08000014 20002009 00202000 000208c0 00280004 5003b800 0600b01e 00102001 80000040 00000000 00040010 00400000 08002002 00004201 40000100 38050f30 20022003 02100018 00112000 00000000 02000000 10000080 08008000 00060001 20084000 00826200 |