On Target OPRK_HUMAN 0.4090909/CHEMBL499352
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.4090909, the most similar ligand is CHEMBL499352. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL499352 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CN(CC(=O)N1CCN(CC1CN2CCCC2)S(=O)(=O)c3ccc(Cl)cc3)c4ccc(Cl)c(Cl)c4 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 0000c092 00802600 01100020 05b00600 00080000 10000010 08020000 20000008 00000000 00408be0 00202004 6000a800 02008006 00002001 80a00040 00008000 00042000 00000000 08600000 00007603 c0100000 38000700 20000023 3a40003a 02002000 0010008c 10080000 1000008c 08008400 20060011 00005002 02032260 |