On Target OPRK_HUMAN 0.397351/CHEMBL499352
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.397351, the most similar ligand is CHEMBL499352. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL499352 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CN(CC(=O)N1CCN(CC1CN2CCCC2)S(=O)(=O)c3ccc(Cl)cc3)c4ccc(Cl)c(Cl)c4 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0000c092 00802600 01100020 05b00600 00080000 10000010 08020000 20000008 00000000 00408be0 00202004 6000a800 02008006 00002001 80a00040 00008000 00042000 00000000 08600000 00007603 c0100000 38000700 20000023 3a40003a 02002000 0010008c 10080000 1000008c 08008400 20060011 00005002 02032260 |