On Target AA1R_HUMAN 0.28834355/CHEMBL209230
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.28834355, the most similar ligand is CHEMBL209230. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL209230 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CCCN1C(=O)Nc2[nH]c(nc2C1=O)c3ccc(cc3)S(=O)(=O)NCc4ccccc4 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 0000803a 00801800 01180100 13b10600 00080068 0000c000 04009001 00081408 16400100 900018e0 0c10a00c 60018800 02009800 00d01001 802a0080 080c000c 00002000 0210a000 00400000 00406000 80000100 38008050 21802041 0870001c 02040000 c0200004 60000000 0004002c 00004404 20460c00 c00c0800 400103e0 |