On Target AOFB_HUMAN 0.29565218/CHEMBL2158247
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.29565218, the most similar ligand is CHEMBL2158247. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL2158247 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | Clc1ccc(Sc2ccc3C(=O)NC(=O)c3c2)cc1 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00008000 00c01a00 80020100 10110600 00040020 08018000 00000000 02001000 01000000 00000840 00200001 60008800 02008806 00210000 00000480 00000000 04003000 02000001 00310000 00000000 80020000 080a8780 00800020 0040000d 00002000 c0200000 10000000 80000000 00000300 00060001 80040000 00030220 |