On Target AOFB_HUMAN 0.34042552/CHEMBL4062286
For the given ligand Oseltamivir, we have found in our database that, being scored 0.34042552, the most similar ligand is CHEMBL4062286. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL4062286 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | COc1c(OC\C=C(/C)\C[C@H]2OC(=O)C(=C2)CCC(=O)N)ccc3C=CC(=O)Oc13 |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 0c050040 01200028 20080108 00210700 001d1214 00400820 02000080 68000602 130a4000 401208c0 40000200 40419000 4682c432 01200080 01000485 02089009 00820010 00000040 08410010 02028003 00040020 18001e88 0120a008 00180010 08601500 00000400 00406011 88100000 06042200 8106080a 04000000 00800010 |