On Target ACM1_HUMAN 0.35/CHEMBL2057767
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.35, the most similar ligand is CHEMBL2057767. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL2057767 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | Clc1nccc2c(cccc12)S(=O)(=O)N3CC(C3)C(=O)N4CCN(CC4)c5ccncc5 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00008012 02802600 01104020 05b00600 000c0000 10000000 00008000 00000008 00000000 00400b60 00202014 60009800 0b008806 00402001 c0e00041 00040004 00046004 00000000 00600010 00007e03 c0100000 38048708 20800021 9a40001a 02006000 0000010c 10008000 0000008c 08000400 20060011 00042000 00030260 |