On Target NMDE2_HUMAN 0.22807017/CHEMBL2013202
For the given ligand Hydralazine, we have found in our database that, being scored 0.22807017, the most similar ligand is CHEMBL2013202. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL2013202 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | CN(C)Cc1c(O)ccc2[nH]c(nc12)c3ccccc3 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 10000002 00000808 20000100 10050610 00040060 00004000 06004000 02081400 00000100 10000850 41208004 40008000 00000806 00408000 00020040 020c200c 00000008 02002008 00200000 40460000 41000000 28008820 21800000 00400100 00046000 80000000 00000040 80000000 00000104 00460c00 44048800 802402a0 |