On Target GRM5_HUMAN 0.34408602/CHEMBL1682803
For the given ligand Hydralazine, we have found in our database that, being scored 0.34408602, the most similar ligand is CHEMBL1682803. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL1682803 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | CN(C)c1ccc(nn1)C#Cc2ccccc2 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 10000203 00020808 20000d08 00090280 01482000 00000002 00800000 00000000 00000000 10000840 00210004 60008000 00000002 40008000 00010000 0004600c 00240000 0200000c 08200000 00220614 00000000 0c800000 20800801 02400000 00160004 80000000 20100200 000000c0 0200000c 00060040 00000000 00000000 |