On Target P2RX3_HUMAN 0.24675325/CHEMBL3901056
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.24675325, the most similar ligand is CHEMBL3901056. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL3901056 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CS(=O)(=O)Nc1ccc(NC2=NC(=O)N(CCO)C(=O)N2Cc3ccc(Cl)cc3)cc1 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00008006 00801000 80000102 02310700 01000000 00008002 00009200 00001800 04000102 00000860 0820200c 40049800 06008c44 00400001 80280040 100a904c 00040040 12084000 08400008 10204000 c0000000 18048940 63004040 85e00004 40002080 80000000 44048000 000400ac 0500c008 00460000 c0040000 02030060 |