On Target 5HT2A_HUMAN 0.4172662/CHEMBL3753681
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.4172662, the most similar ligand is CHEMBL3753681. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL3753681 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CN(C)CCN(Cc1ccccc1)S(=O)(=O)c2ccc(cc2)N3CCN(CC3)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0000c092 00802000 01080120 05b10600 00080010 00000000 0c020001 02001008 00000000 00011a40 00302004 60008800 02000806 00002001 80200440 00008000 00042000 02100000 08600000 00006000 c0100000 28008100 20000020 2a40002a 02002000 c0000004 40000000 800000cc 08008500 20060000 00040002 00030360 |