On Target 5HT2A_HUMAN 0.51898736/CHEMBL473765
For the given ligand Oseltamivir, we have found in our database that, being scored 0.51898736, the most similar ligand is CHEMBL473765. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL473765 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CC1CC2(OC(=O)C)C=C(C)C1C3C2C(=O)N(CCCCN4CCN(CC4)c5ccccc5)C3=O |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00074002 01001000 00100120 04010700 001c0000 00200810 02000000 28000402 10200000 00108ac8 40200004 40039000 1402800a 00882000 00000440 00081008 00a64000 00000120 2ac12010 02000201 40120020 38140e10 210080a1 0210001a 00201401 00000400 0040c200 90000080 0c008202 80060007 24020000 00802a10 |