On Target OPRM_MOUSE 0.25/CHEMBL2311130
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL2311130. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL2311130 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | CN(C)[C@H]1CCCC[C@@H]1N(C)C(=O)c2ccc(Cl)c(Cl)c2 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00008000 09003800 00100100 04010600 00000000 00000000 04000000 22001008 00000000 000908c8 00200000 40018800 02008846 00002000 80000400 00000000 00000000 02000000 02002000 00000201 00000000 38068710 00000000 0250001c 00002000 c0100000 00040000 90000000 08000100 00060801 a0040000 00020200 |