On Target OPRM_MOUSE 0.30414745/CHEMBL2147918
For the given ligand Omeprazole, we have found in our database that, being scored 0.30414745, the most similar ligand is CHEMBL2147918. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL2147918 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | Cl.COc1ccc2cc3C[C@@]4(O)[C@H]5Cc6ccc(O)cc6[C@@]4(CCN5C)Cc3nc2c1 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 0200000a 43004208 2010450a 10810610 001413e1 40000002 07003000 20000009 00500880 000808c0 08308004 50818000 00000802 00600a00 018e0061 020e000c 18000200 06000004 00602408 00060201 40300100 18308018 23c040c0 81500010 00040800 80000001 08120040 10000080 04400206 0086080a 00060000 20262f00 |