On Target P2Y12_HUMAN 0.37096775/CHEMBL2402253
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.37096775, the most similar ligand is CHEMBL2402253. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL2402253 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CCOC(=O)c1cnc(N2CCN(CC2)C(=O)NS(=O)(=O)c3ccc(Cl)cc3)c(Cl)c1 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0000c012 10802a00 012041a0 86b80e10 00041010 10004000 08000000 08403008 10000100 20002a40 00202004 e0008c00 0600a80e 0001a041 80200900 121c000c 02062010 12004004 08610008 00a06000 c0102000 2e058f40 20800820 0a61000e 00042c00 00002600 98080080 0000048c 0cc08618 20060801 c0001000 00030260 |