On Target P2Y12_HUMAN 0.30612245/CHEMBL2419492
For the given ligand Omeprazole, we have found in our database that, being scored 0.30612245, the most similar ligand is CHEMBL2419492. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL2419492 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | CCOC(=O)c1cc(C#N)c(nc1C)N2CCC(CC2)C(=O)NS(=O)(=O)Cc3ccc(OC)cc3 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00024002 07800828 2010618c 91790610 21041030 0000e040 12140004 20109000 10200100 20c108d4 0020240c 50839800 04009822 00258001 81420901 1a0c000e 02460008 02004104 08a10000 44a24201 c0100000 1c84ae40 20800d01 3270003c 02040400 80002000 080a04c0 1000108c 0440820d 00060800 c0201004 00810270 |