On Target NOS2_HUMAN 0.27407408/CHEMBL490886
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.27407408, the most similar ligand is CHEMBL490886. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL490886 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | Cl.CC(=N)NCc1cccc(CNS(=O)(=O)c2ccc(C)cc2)c1 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00000010 00801000 01080100 01b10600 00080009 00000000 14000001 02001000 00000000 00001853 00302000 60008000 00000802 00000001 80200400 00100008 00002000 02100000 00400800 00006000 80000000 08008000 00000000 08400008 02000000 c0000004 48000000 9000002c 00000510 20060000 00040000 00030360 |