On Target SCN9A_HUMAN 0.30833334/CHEMBL3914908
For the given ligand Hydralazine, we have found in our database that, being scored 0.30833334, the most similar ligand is CHEMBL3914908. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL3914908 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | CN(N)c1nc(c2ccc(Oc3ccc(F)cc3)cc2)c4ccccc4n1 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 0000a003 00000808 a0100108 02050600 01041004 00004010 02042000 00080000 00000100 10000840 01200004 60008800 02000032 00501000 01030041 000c000c 00020000 02006000 04602000 00e20000 40400000 0c022028 70803840 00600108 00020000 80000000 00020000 00200061 0000421c 004e8800 40000c00 100002a0 |