On Target PRGR_HUMAN 0.32524273/CHEMBL3605924
For the given ligand Omeprazole, we have found in our database that, being scored 0.32524273, the most similar ligand is CHEMBL3605924. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL3605924 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | COc1cc(NS(=O)(=O)C)c2[nH]c(C)c(c3cc(F)ccc3OC)c2c1 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00002002 8000080d 2010050e 12310630 00041020 0c000018 060c0000 00403000 06000000 20002840 00002004 70008000 00008c16 08709001 a10a0041 8206200c 00020000 86000404 04200000 00424600 40000000 08028a08 30801000 8040c008 00042081 80080000 18020280 0000004d 0040430c 10468000 00040608 000102e0 |