On Target CXCR1_HUMAN 0.24812031/CHEMBL3701188
For the given ligand Oseltamivir, we have found in our database that, being scored 0.24812031, the most similar ligand is CHEMBL3701188. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3701188 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | COC(=O)[C@H]1CCCN1C(=O)c2cccc(NC3=C(N[C@@H](c4oc(C)cc4)C5(C)COC5)C(=O)C3=O)c2O |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 1041c08a 01205808 e0180102 00012700 24090081 68022018 020000a0 226d1500 05a04d40 001a08d0 00380034 5043b800 ce088c1a 01200008 800a1460 10086048 10a75001 22008c00 08e30210 26020201 48101980 18169e00 330000c0 0058801c 04841031 c0000280 24d00010 980c0581 20508302 a0064013 a4045420 40002600 |