On Target PGH2_HUMAN 0.36923078/CHEMBL52872
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.36923078, the most similar ligand is CHEMBL52872. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL52872 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CN(C)c1ccc(cc1Cl)c2cc(F)c(F)cc2c3ccc(cc3)S(=O)(=O)N |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0000a012 00801801 01100100 02b10200 00800008 00000010 04000000 08000004 02000000 00002840 00202084 70008800 02008004 00209001 a0200040 00000000 00061080 02000000 0c000000 00102000 c0000000 08020100 30000000 08400008 00002000 80000400 00000000 000000e9 0000c000 20068000 00000000 00030220 |