On Target PGH2_HUMAN 0.28089887/CHEMBL347198
For the given ligand Hydralazine, we have found in our database that, being scored 0.28089887, the most similar ligand is CHEMBL347198. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL347198 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | COc1ccc(NNC(=O)c2ccccc2)cc1 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 00000006 08000808 20080108 00010600 00001000 00000000 02000020 00001008 00004000 00000840 00100004 40008000 00008842 00000000 21000041 0000004c 00000000 02000000 04000004 00220000 40000000 0c028600 60000800 00600004 00000000 90000000 04040000 00000000 00000200 004e0002 80040000 00000180 |