On Target TRY1_HUMAN 0.4054054/CHEMBL141574
For the given ligand Oseltamivir, we have found in our database that, being scored 0.4054054, the most similar ligand is CHEMBL141574. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL141574 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CCCC(CCC)C(=O)N[C@@H](CC(=O)OC)C(=O)N1CCC[C@@H]1C(=O)N[C@H]2CCCC(C2O)C(=N)N |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00070000 01007000 00100100 04010d00 00180080 00000010 00000000 2000600a 00200000 00000083 00210000 4003b000 0e008012 00802001 80180008 00080008 10220000 00000101 02c02010 00000201 00000000 30150e30 03000083 02100018 00001001 00000000 40000200 10000000 08000202 00040001 20024000 00802a00 |