On Target ACE_HUMAN 0.24867725/CHEMBL514138
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.24867725, the most similar ligand is CHEMBL514138. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL514138 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | Cl.COc1ccc(cc1)S(=O)(=O)N(Cc2cccnc2)[C@H](C(C)C)C(=O)NO |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 10008212 0080c018 61184108 01b00610 000c9000 00000000 06084001 02001000 00000080 004118c0 03302004 6000b000 06008806 00000001 81200401 0004801c 00022000 0210000c 00600800 000e6601 c0040080 38008e01 20800000 3a400038 02040000 40000004 c8800000 8000008c 08400700 20060004 20004002 80430360 |