On Target TLR4_HUMAN 0.25465837/CHEMBL3823499
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.25465837, the most similar ligand is CHEMBL3823499. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL3823499 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CC(C)(C)S(=O)(=O)c1ccc2nccc(Nc3n[nH]c4ccc(F)cc34)c2c1 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00000003 04802208 20124000 02900200 01040000 00000030 02808010 00000008 00002100 10004840 8070a004 60008000 00000822 00441000 80600040 000c400e 04040000 00000000 08600002 00222801 c0080000 0c048008 20800800 88200019 00120000 00000080 22048000 008000c1 00008008 00068000 50040000 00014260 |