On Target OPRD_HUMAN 0.296875/CHEMBL3185265
For the given ligand Hydralazine, we have found in our database that, being scored 0.296875, the most similar ligand is CHEMBL3185265. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL3185265 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | CN(C)c1cccc2c1c(NC(=O)Nc3ccc(OCc4ccccc4)cc3)nn2C |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 04000007 00000408 20100108 00010e40 080c1000 00004000 02800800 00002009 00000100 100008c0 00380004 40218000 00808023 00510000 01000041 021c400c 00040000 0a000000 08600000 00220000 c0000180 1c010438 20827804 02e11020 001a0000 80202000 20050480 100000c0 00008218 00060101 40000000 00004260 |