On Target CNR2_HUMAN 0.46875/CHEMBL3597331
For the given ligand Oseltamivir, we have found in our database that, being scored 0.46875, the most similar ligand is CHEMBL3597331. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3597331 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | COC[C@@H](COC(=O)C)N(C)C(=O)CC\C=C\CCCCC(Cl)CCCCCC(Cl)Cl |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00020000 01004000 00100300 80010600 001000c0 00000000 00000000 20000402 10000000 01100080 00200000 40009000 04028002 00000000 00081408 00080008 10064000 00000000 01002000 02000201 00000020 10000f00 13008000 00000018 00200440 08000000 00c04000 90000001 04000200 80040009 24020000 00820a00 |