On Target NTRK1_HUMAN 0.31944445/CHEMBL1996795
For the given ligand Chlorpropamide, we have found in our database that, being scored 0.31944445, the most similar ligand is CHEMBL1996795. Check out the elaboration below.
| Chlorpropamide (Given Ligand) | CHEMBL1996795 (Similar Ligand) |
|---|---|
| CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 | Nc1cc(ccc1NC2CCCCC2)S(=O)(=O)NC(=O)c3ccc(cc3)c4ccc(F)cc4 |
|
|
|
|
|
|
| 00008010 00801200 01100000 02b00e00 00000000 10000000 08000000 00003000 00000000 00002840 00202000 e0008c00 02009004 00000041 80200000 00000000 02002000 00000000 00400000 00006000 80002000 18010500 00000000 08400018 00002000 00000000 90000000 0000040c 00000400 20060001 00000000 00030260 | 00006012 01802800 01180100 43b10600 20880210 00022010 04000001 00101008 00000100 000038c0 00302004 60018000 80008800 00001001 80260140 00000200 02062000 02104000 0e402000 10106001 c0100000 1802a610 30000000 0850001c 02000000 80000004 40000000 100000cd 0000c400 20068000 80041000 00010360 |