On Target NTRK1_HUMAN 0.5/CHEMBL1971519
For the given ligand Hydralazine, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL1971519. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL1971519 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | Nc1n[nH]c2cccc(c3ccc(F)cc3)c12 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 00002003 00000008 20100100 02010200 00840004 00000010 02000000 00000000 00000000 10000840 00000004 60008000 00000012 00401000 00000040 0004400c 00020000 02000000 04600000 00320000 40000000 0c000008 30800800 00600008 00160000 80080000 00060240 00000041 00004008 00068000 00000000 00004260 |