On Target NTRK1_HUMAN 0.25943395/CHEMBL416056
For the given ligand Oseltamivir, we have found in our database that, being scored 0.25943395, the most similar ligand is CHEMBL416056. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL416056 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | COC(=O)[C@]1(O)C[C@@H]2O[C@@]1(C)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00060002 01c09800 00000100 90010700 003e00e0 00308000 00008c00 82001004 00000000 018008d0 00200004 4003d002 9c008802 00e80100 000c14c0 001cd00c 08a22028 02800184 19e01000 00000001 c0080020 18068e98 27800000 8c50001c 10004400 c0200002 00008340 90000070 00400301 00060041 803d8200 00000220 |